| Name |
N-[Cyano-[4-(trifluoromethoxy)phenyl]methyl]-2,3-dihydropyrazolo[5,1-b][1,3]oxazole-6-carboxamide
|
| Molecular Formula |
C15H11F3N4O3
|
| Molecular Weight |
352.27
|
| Smiles |
N#CC(NC(=O)c1cc2n(n1)CCO2)c1ccc(OC(F)(F)F)cc1
|
N#CC(NC(=O)c1cc2n(n1)CCO2)c1ccc(OC(F)(F)F)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.