| Name |
iso-Boc-His(Dnp)-OH-IPA
|
| Molecular Formula |
C20H27N5O9
|
| Molecular Weight |
481.5
|
| Smiles |
CC(C)(C)OC(=O)NC(Cc1cncn1-c1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)O.CC(C)O
|
CC(C)(C)OC(=O)NC(Cc1cncn1-c1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)O.CC(C)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.