| Name |
2-Pyridinecarboxaldehyde, 6-chloro-4-(1,1-dimethylethyl)-
|
| Molecular Formula |
C10H12ClNO
|
| Molecular Weight |
197.66
|
| Smiles |
CC(C)(C)c1cc(Cl)nc(C=O)c1
|
CC(C)(C)c1cc(Cl)nc(C=O)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.