| Name |
3,3',5,5'-Tetramethyl-6'-((prop-2-yn-1-yloxy)methyl)-[2,2'-bidithieno[3,2-b:2',3'-d]thiophene]-6-carbonitrile 4,4-dioxide
|
| Molecular Formula |
C25H17NO3S6
|
| Molecular Weight |
571.8
|
| Smiles |
C#CCOCc1sc2c(sc3c(C)c(-c4sc5c(c4C)S(=O)(=O)c4c-5sc(C#N)c4C)sc32)c1C
|
C#CCOCc1sc2c(sc3c(C)c(-c4sc5c(c4C)S(=O)(=O)c4c-5sc(C#N)c4C)sc32)c1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.