| Name |
Tert-butyl 2-amino-2-(2,6-difluorophenyl)acetate
|
| Molecular Formula |
C12H15F2NO2
|
| Molecular Weight |
243.25
|
| Smiles |
CC(C)(C)OC(=O)C(N)c1c(F)cccc1F
|
CC(C)(C)OC(=O)C(N)c1c(F)cccc1F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.