| Name |
1,1-dioxo-2H,3H,4H-1lambda6-pyrazolo[1,5-e][1,2,5]thiadiazine-7-carboxylic acid
|
| Molecular Formula |
C6H7N3O4S
|
| Molecular Weight |
217.21
|
| Smiles |
O=C(O)c1cc2n(n1)CCNS2(=O)=O
|
O=C(O)c1cc2n(n1)CCNS2(=O)=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.