| Name |
2,3-Difluoro-4-methoxy-1,5-phenylenediboronic acid
|
| Molecular Formula |
C7H8B2F2O5
|
| Molecular Weight |
231.76
|
| Smiles |
COc1c(B(O)O)cc(B(O)O)c(F)c1F
|
COc1c(B(O)O)cc(B(O)O)c(F)c1F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.