| Name |
1,1a(2)-(1,6-Dichloro-2,4-hexadiyne-1,6-diyl)bis[benzene]
|
| Molecular Formula |
C18H12Cl2
|
| Molecular Weight |
299.2
|
| Smiles |
ClC(C#CC#CC(Cl)c1ccccc1)c1ccccc1
|
ClC(C#CC#CC(Cl)c1ccccc1)c1ccccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.