| Name |
3-(3,5-Dichloro-4-hydroxy-phenylimino)-5-nitro-1,3-dihydro-indol-2-one
|
| Molecular Formula |
C14H7Cl2N3O4
|
| Molecular Weight |
352.1
|
| Smiles |
O=C1Nc2ccc([N+](=O)[O-])cc2C1=Nc1cc(Cl)c(O)c(Cl)c1
|
O=C1Nc2ccc([N+](=O)[O-])cc2C1=Nc1cc(Cl)c(O)c(Cl)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.