| Name |
Sodium;4,5-dihydroxy-3,6-bis[(2-sulfonatophenyl)diazenyl]naphthalene-2,7-disulfonate
|
| Molecular Formula |
C22H12N4NaO14S4-3
|
| Molecular Weight |
707.6
|
| Smiles |
O=S(=O)([O-])c1ccccc1N=Nc1c(S(=O)(=O)[O-])cc2cc(S(=O)(=O)[O-])c(N=Nc3ccccc3S(=O)(=O)[O-])c(O)c2c1O.[Na+]
|
O=S(=O)([O-])c1ccccc1N=Nc1c(S(=O)(=O)[O-])cc2cc(S(=O)(=O)[O-])c(N=Nc3ccccc3S(=O)(=O)[O-])c(O)c2c1O.[Na+]
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.