| Name |
3-(2,4-Dihydro-1-oxo-1,2,4-triazolo(3,4-c)(1,4)-benzoxazin-2-yl)propionitrile
|
| Molecular Formula |
C12H10N4O2
|
| Molecular Weight |
242.23
|
| Smiles |
N#CCCn1nc2n(c1=O)-c1ccccc1OC2
|
N#CCCn1nc2n(c1=O)-c1ccccc1OC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.