| Name |
2-Chloro-7-(3,4-difluorophenyl)-N,5,5-trimethyl-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-4-amine
|
| Molecular Formula |
C15H15ClF2N4
|
| Molecular Weight |
324.75
|
| Smiles |
CNc1nc(Cl)nc2c1C(C)(C)CN2c1ccc(F)c(F)c1
|
CNc1nc(Cl)nc2c1C(C)(C)CN2c1ccc(F)c(F)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.