| Name |
4-[5-(3-Bromophenyl)-1,2,4-oxadiazol-3-yl]phenol
|
| Molecular Formula |
C14H9BrN2O2
|
| Molecular Weight |
317.14
|
| Smiles |
Oc1ccc(-c2noc(-c3cccc(Br)c3)n2)cc1
|
Oc1ccc(-c2noc(-c3cccc(Br)c3)n2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.