| Name |
2-(9'-Chloro-1-ethyl-1',10b'-dihydrospiro[piperidine-4,5'-pyrazolo[1,5-c][1,3]benzoxazin]-2'-yl)phenol
|
| Molecular Formula |
C22H24ClN3O2
|
| Molecular Weight |
397.9
|
| Smiles |
CCN1CCC2(CC1)Oc1ccc(Cl)cc1C1CC(c3ccccc3O)=NN12
|
CCN1CCC2(CC1)Oc1ccc(Cl)cc1C1CC(c3ccccc3O)=NN12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.