| Name |
Anthra[2,1,9-def:6,5,10-d'e'f']diisoquinoline-1,3,8,10-tetrayl tetrakis(2,2-dimethylpropanoate)
|
| Molecular Formula |
C44H44N2O8
|
| Molecular Weight |
728.8
|
| Smiles |
CC(C)(C)C(=O)Oc1nc(OC(=O)C(C)(C)C)c2ccc3c4ccc5c(OC(=O)C(C)(C)C)nc(OC(=O)C(C)(C)C)c6ccc(c7ccc1c2c73)c4c65
|
CC(C)(C)C(=O)Oc1nc(OC(=O)C(C)(C)C)c2ccc3c4ccc5c(OC(=O)C(C)(C)C)nc(OC(=O)C(C)(C)C)c6ccc(c7ccc1c2c73)c4c65
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.