| Name |
4-Chloro-2-(2-chloro-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl)phenyl acetate
|
| Molecular Formula |
C19H11Cl2F17O2
|
| Molecular Weight |
665.2
|
| Smiles |
CC(=O)Oc1ccc(Cl)cc1CC(Cl)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F
|
CC(=O)Oc1ccc(Cl)cc1CC(Cl)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.