| Name |
2-[2-(Morpholin-4-yl)ethoxy]ethyl 3-phenyl-2,3-dihydro-1,4-benzodioxine-2-carboxylate--hydrogen chloride (1/1)
|
| Molecular Formula |
C23H28ClNO6
|
| Molecular Weight |
449.9
|
| Smiles |
Cl.O=C(OCCOCCN1CCOCC1)C1Oc2ccccc2OC1c1ccccc1
|
Cl.O=C(OCCOCCN1CCOCC1)C1Oc2ccccc2OC1c1ccccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.