| Name |
1-{8-Oxa-11-azatricyclo[4.3.3.0,1,6]dodecan-11-yl}prop-2-en-1-one
|
| Molecular Formula |
C13H19NO2
|
| Molecular Weight |
221.29
|
| Smiles |
C=CC(=O)N1CC23CCCCC2(COC3)C1
|
C=CC(=O)N1CC23CCCCC2(COC3)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.