| Name |
1-(3-Methoxyphenyl)-4-{2-methylpyrazolo[1,5-a]pyrazin-4-yl}piperazine
|
| Molecular Formula |
C18H21N5O
|
| Molecular Weight |
323.4
|
| Smiles |
COc1cccc(N2CCN(c3nccn4nc(C)cc34)CC2)c1
|
COc1cccc(N2CCN(c3nccn4nc(C)cc34)CC2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.