| Name |
ethyl 2-({[(5-methyl-7-oxo-7,8-dihydro[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)thio]acetyl}amino)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate
|
| Molecular Formula |
C20H23N5O4S2
|
| Molecular Weight |
461.6
|
| Smiles |
CCOC(=O)c1c(NC(=O)CSc2nnc3[nH]c(=O)cc(C)n23)sc2c1CCCCC2
|
CCOC(=O)c1c(NC(=O)CSc2nnc3[nH]c(=O)cc(C)n23)sc2c1CCCCC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.