| Name |
2-O-benzyl 7-O-tert-butyl 5-methyl-2,7-diazaspiro[3.5]nonane-2,7-dicarboxylate
|
| Molecular Formula |
C21H30N2O4
|
| Molecular Weight |
374.5
|
| Smiles |
CC1CN(C(=O)OC(C)(C)C)CCC12CN(C(=O)OCc1ccccc1)C2
|
CC1CN(C(=O)OC(C)(C)C)CCC12CN(C(=O)OCc1ccccc1)C2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.