| Name |
2-Nitro-3-(2H-1,2,3-triazol-2-yl)pyridine
|
| Molecular Formula |
C7H5N5O2
|
| Molecular Weight |
191.15
|
| Smiles |
O=[N+]([O-])c1ncccc1-n1nccn1
|
O=[N+]([O-])c1ncccc1-n1nccn1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.