| Name |
1H-Benz[e]indolium, 2,3-dihydro-2,3,3-trimethyl-, inner salt
|
| Molecular Formula |
C15H17N
|
| Molecular Weight |
211.30
|
| Smiles |
C[C-]1Cc2c(ccc3ccccc23)[N+]1(C)C
|
C[C-]1Cc2c(ccc3ccccc23)[N+]1(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.