| Name |
2-Amino-6-bromopyrrolo[2,1-f][1,2,4]triazin-4(3H)-one
|
| Molecular Formula |
C6H5BrN4O
|
| Molecular Weight |
229.03
|
| Smiles |
Nc1nn2cc(Br)cc2c(=O)[nH]1
|
Nc1nn2cc(Br)cc2c(=O)[nH]1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.