| Name |
Disodium 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl phosphate
|
| Molecular Formula |
C7H5F12Na2O4P+2
|
| Molecular Weight |
458.05
|
| Smiles |
O=P(O)(O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F.[Na+].[Na+]
|
O=P(O)(O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F.[Na+].[Na+]
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.