| Name |
2-{3-bromo-2-propyl-4H,5H,6H,7H-pyrazolo[1,5-a]pyrimidin-6-yl}ethan-1-ol
|
| Molecular Formula |
C11H18BrN3O
|
| Molecular Weight |
288.18
|
| Smiles |
CCCc1nn2c(c1Br)NCC(CCO)C2
|
CCCc1nn2c(c1Br)NCC(CCO)C2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.