| Name |
7-(oxolan-2-yl)-4H,5H,6H,7H-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine
|
| Molecular Formula |
C9H15N5O
|
| Molecular Weight |
209.25
|
| Smiles |
Nc1nc2n(n1)C(C1CCCO1)CCN2
|
Nc1nc2n(n1)C(C1CCCO1)CCN2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.