| Name |
4-Amino-6-(5-methyl-1,2-oxazol-3-YL)-2,5-dihydro-1,3,5-triazin-2-one
|
| Molecular Formula |
C7H7N5O2
|
| Molecular Weight |
193.16
|
| Smiles |
Cc1cc(-c2nc(N)nc(=O)[nH]2)no1
|
Cc1cc(-c2nc(N)nc(=O)[nH]2)no1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.