| Name |
2-((2-fluorobenzyl)thio)-5-(4-hydroxyphenyl)-7,8,9,10-tetrahydropyrimido[4,5-b]quinoline-4,6(3H,5H)-dione
|
| Molecular Formula |
C24H20FN3O3S
|
| Molecular Weight |
449.5
|
| Smiles |
O=C1CCCC2=C1C(c1ccc(O)cc1)c1c(nc(SCc3ccccc3F)[nH]c1=O)N2
|
O=C1CCCC2=C1C(c1ccc(O)cc1)c1c(nc(SCc3ccccc3F)[nH]c1=O)N2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.