| Name |
4-{[(E)-(2-hydroxy-3,5-diiodophenyl)methylidene]amino}-5-(4-methoxyphenyl)-2,4-dihydro-3H-1,2,4-triazole-3-thione
|
| Molecular Formula |
C16H12I2N4O2S
|
| Molecular Weight |
578.2
|
| Smiles |
COc1ccc(-c2n[nH]c(=S)n2N=Cc2cc(I)cc(I)c2O)cc1
|
COc1ccc(-c2n[nH]c(=S)n2N=Cc2cc(I)cc(I)c2O)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.