| Name |
7-(3,4-difluorophenyl)-3-{[2-(3,4-dimethylphenyl)-1-methyl-2-oxoethyl]thio}[1,2,4]triazolo[4,3-a]pyrazin-8(7H)-one
|
| Molecular Formula |
C22H18F2N4O2S
|
| Molecular Weight |
440.5
|
| Smiles |
Cc1ccc(C(=O)C(C)Sc2nnc3c(=O)n(-c4ccc(F)c(F)c4)ccn23)cc1C
|
Cc1ccc(C(=O)C(C)Sc2nnc3c(=O)n(-c4ccc(F)c(F)c4)ccn23)cc1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.