| Name |
1,3-Benzenedicarboxylic acid, 5-(1,3-dihydro-4-methyl-1,3-dioxo-2H-isoindol-2-yl)-
|
| Molecular Formula |
C17H11NO6
|
| Molecular Weight |
325.27
|
| Smiles |
Cc1cccc2c1C(=O)N(c1cc(C(=O)O)cc(C(=O)O)c1)C2=O
|
Cc1cccc2c1C(=O)N(c1cc(C(=O)O)cc(C(=O)O)c1)C2=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.