| Name |
(1S)-2-{[4-carbamoyl-1-(tetrahydro-2H-pyran-4-yl)-1H-pyrazol-5-yl]amino}-1-methyl-2-oxoethyl acetate
|
| Molecular Formula |
C14H20N4O5
|
| Molecular Weight |
324.33
|
| Smiles |
CC(=O)OC(C)C(=O)Nc1c(C(N)=O)cnn1C1CCOCC1
|
CC(=O)OC(C)C(=O)Nc1c(C(N)=O)cnn1C1CCOCC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.