| Name |
2-{[4-(methylsulfonyl)benzyl]oxy}-1H-isoindole-1,3(2H)-dione
|
| Molecular Formula |
C16H13NO5S
|
| Molecular Weight |
331.3
|
| Smiles |
CS(=O)(=O)c1ccc(CON2C(=O)c3ccccc3C2=O)cc1
|
CS(=O)(=O)c1ccc(CON2C(=O)c3ccccc3C2=O)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.