| Name |
[1,1a(2):4a(2),1a(2)a(2)-Terphenyl]-4,4a(2)a(2)-dimethanol, I+/-,I+/-,I+/-a(2),I+/-a(2)-tetramethyl-
|
| Molecular Formula |
C24H26O2
|
| Molecular Weight |
346.5
|
| Smiles |
CC(C)(O)c1ccc(-c2ccc(-c3ccc(C(C)(C)O)cc3)cc2)cc1
|
CC(C)(O)c1ccc(-c2ccc(-c3ccc(C(C)(C)O)cc3)cc2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.