| Name |
2-(2-bromophenyl)-4,5-dimethyl-1H-imidazole
|
| Molecular Formula |
C11H11BrN2
|
| Molecular Weight |
251.12
|
| Smiles |
Cc1nc(-c2ccccc2Br)[nH]c1C
|
Cc1nc(-c2ccccc2Br)[nH]c1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.