| Name |
2-Benzyl-1-oxo-1,2-dihydroisoquinoline-4-carboxylic acid
|
| Molecular Formula |
C17H13NO3
|
| Molecular Weight |
279.29
|
| Smiles |
O=C(O)c1cn(Cc2ccccc2)c(=O)c2ccccc12
|
O=C(O)c1cn(Cc2ccccc2)c(=O)c2ccccc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.