| Name |
2,6-Difluoro-3-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-YL)pyridine
|
| Molecular Formula |
C11H14BF2NO2
|
| Molecular Weight |
241.04
|
| Smiles |
CC1CC(C)(C)OB(c2ccc(F)nc2F)O1
|
CC1CC(C)(C)OB(c2ccc(F)nc2F)O1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.