| Name |
2-(1,3-Dioxan-2-YL)-4-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-YL)phenol
|
| Molecular Formula |
C16H23BO5
|
| Molecular Weight |
306.2
|
| Smiles |
CC1CC(C)(C)OB(c2ccc(O)c(C3OCCCO3)c2)O1
|
CC1CC(C)(C)OB(c2ccc(O)c(C3OCCCO3)c2)O1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.