| Name |
2,2'-(Propane-2,2-diyl)bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolane)
|
| Molecular Formula |
C15H30B2O4
|
| Molecular Weight |
296.0
|
| Smiles |
CC(C)(B1OC(C)(C)C(C)(C)O1)B1OC(C)(C)C(C)(C)O1
|
CC(C)(B1OC(C)(C)C(C)(C)O1)B1OC(C)(C)C(C)(C)O1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.