| Name |
3-ethyl-7-(3-(o-tolyl)-1,2,4-oxadiazol-5-yl)quinazoline-2,4(1H,3H)-dione
|
| Molecular Formula |
C19H16N4O3
|
| Molecular Weight |
348.4
|
| Smiles |
CCn1c(=O)[nH]c2cc(-c3nc(-c4ccccc4C)no3)ccc2c1=O
|
CCn1c(=O)[nH]c2cc(-c3nc(-c4ccccc4C)no3)ccc2c1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.