| Name |
2,4-dibromo-6H-thieno[2,3-b]pyrrole-5-carboxylic acid
|
| Molecular Formula |
C7H3Br2NO2S
|
| Molecular Weight |
324.98
|
| Smiles |
O=C(O)c1[nH]c2sc(Br)cc2c1Br
|
O=C(O)c1[nH]c2sc(Br)cc2c1Br
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.