| Name |
4-(4-Chlorophenyl)-4,5-dihydro-2,3-dimethylpyrrolo[3,4-c]pyrazol-6(2h)-one
|
| Molecular Formula |
C13H12ClN3O
|
| Molecular Weight |
261.70
|
| Smiles |
Cc1c2c(nn1C)C(=O)NC2c1ccc(Cl)cc1
|
Cc1c2c(nn1C)C(=O)NC2c1ccc(Cl)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.