| Name |
(5S)-8-Chloro-3,4,5,6-tetrahydro-2,5-methanopyrido[2,3-g][1,2,6]thiadiazocine 1,1-dioxide
|
| Molecular Formula |
C9H10ClN3O2S
|
| Molecular Weight |
259.71
|
| Smiles |
O=S1(=O)c2ccc(Cl)nc2NC2CCN1C2
|
O=S1(=O)c2ccc(Cl)nc2NC2CCN1C2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.