| Name |
Methyl 2-chloro-1'-methyl-5'-morpholino-6'-oxo-1',6'-dihydro-[3,3'-bipyridine]-5-carboxylate
|
| Molecular Formula |
C17H18ClN3O4
|
| Molecular Weight |
363.8
|
| Smiles |
COC(=O)c1cnc(Cl)c(-c2cc(N3CCOCC3)c(=O)n(C)c2)c1
|
COC(=O)c1cnc(Cl)c(-c2cc(N3CCOCC3)c(=O)n(C)c2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.