| Name |
Spiro[naphthalene-1(2H),4a(2)-[4H]pyran]-2-acetic acid, 2a(2),3,3a(2),4,5a(2),6a(2)-hexahydro-6-hydroxy-
|
| Molecular Formula |
C16H20O4
|
| Molecular Weight |
276.33
|
| Smiles |
O=C(O)CC1CCc2cc(O)ccc2C12CCOCC2
|
O=C(O)CC1CCc2cc(O)ccc2C12CCOCC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.