| Name |
Benzenesulfonamide, 4-bromo-2-fluoro-N-[3-(1H-1,2,3-triazol-1-yl)propyl]-
|
| Molecular Formula |
C11H12BrFN4O2S
|
| Molecular Weight |
363.21
|
| Smiles |
O=S(=O)(NCCCn1ccnn1)c1ccc(Br)cc1F
|
O=S(=O)(NCCCn1ccnn1)c1ccc(Br)cc1F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.