| Name |
1,1a(2)-Diethyl (2E,2a(2)E)-4,4a(2)-[(3,6-dioxo-2,5-piperazinediyl)bis(4,1-butanediylimino)]bis[4-oxo-2-butenoate]
|
| Molecular Formula |
C24H36N4O8
|
| Molecular Weight |
508.6
|
| Smiles |
CCOC(=O)C=CC(=O)NCCCCC1NC(=O)C(CCCCNC(=O)C=CC(=O)OCC)NC1=O
|
CCOC(=O)C=CC(=O)NCCCCC1NC(=O)C(CCCCNC(=O)C=CC(=O)OCC)NC1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.