| Name |
3,6-Diamino-1,2-benzisoxazole-7-carboxamide
|
| Molecular Formula |
C8H8N4O2
|
| Molecular Weight |
192.17
|
| Smiles |
NC(=O)c1c(N)ccc2c(N)noc12
|
NC(=O)c1c(N)ccc2c(N)noc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.