| Name |
Tetrahydrofuran-3-yl (1-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)pyrrolidin-3-yl)carbamate
|
| Molecular Formula |
C14H18N6O3
|
| Molecular Weight |
318.33
|
| Smiles |
O=C(NC1CCN(c2ccc3nncn3n2)C1)OC1CCOC1
|
O=C(NC1CCN(c2ccc3nncn3n2)C1)OC1CCOC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.